ChemNet > CAS > 191-24-2 Benzo[ghi]perylene
191-24-2 Benzo[ghi]perylene
שם המוצר |
Benzo[ghi]perylene |
נרדפות |
1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
מולקולרית פורמולה |
C22H12 |
משקל מולקולרי |
276.3307 |
InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
מספר CAS |
191-24-2 |
EINECS |
205-883-8 |
מבנה מולקולרי |
|
צפיפות |
1.378g/cm3 |
נקודת ההתוך |
276-280℃ |
נקודת רתיחה |
501°C at 760 mmHg |
משקל סגולי |
2.009 |
נקודת הבזק |
247.2°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R40:Possible risks of irreversible effects.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|